C21H29N3O4S — CID 4991608
N-(3-methoxypropyl)-2-[[3-methoxypropyl-(2-methylbenzoyl)amino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 4991608) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[[3-methoxypropyl-(2-methylbenzoyl)amino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-methoxypropyl)-2-[[3-methoxypropyl-(2-methylbenzoyl)amino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 4991608 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-(3-methoxypropyl)-2-[[3-methoxypropyl-(2-methylbenzoyl)amino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | COCCCNC(=O)c1csc(CN(CCCOC)C(=O)c2ccccc2C)n1 |
| InChI | InChI=1S/C21H29N3O4S/c1-16-8-4-5-9-17(16)21(26)24(11-7-13-28-3)14-19-23-18(15-29-19)20(25)22-10-6-12-27-2/h4-5,8-9,15H,6-7,10-14H2,1-3H3,(H,22,25) |
| InChIKey | IRXOGEPNLGKANU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|