C11H14ClNO2S — CID 107031103
2-chloro-N-(3-hydroxy-2-methylpropyl)-5-sulfanylbenzamide (PubChem CID 107031103) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is 2-chloro-N-(3-hydroxy-2-methylpropyl)-5-sulfanylbenzamide.
| Compound Name | 2-chloro-N-(3-hydroxy-2-methylpropyl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107031103 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-chloro-N-(3-hydroxy-2-methylpropyl)-5-sulfanylbenzamide |
| SMILES | CC(CO)CNC(=O)c1cc(S)ccc1Cl |
| InChI | InChI=1S/C11H14ClNO2S/c1-7(6-14)5-13-11(15)9-4-8(16)2-3-10(9)12/h2-4,7,14,16H,5-6H2,1H3,(H,13,15) |
| InChIKey | LUDLBPMZGBXSFL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|