C11H12Cl2INO2 — CID 65036837
3,5-dichloro-N-(3-hydroxy-2-methylpropyl)-2-iodobenzamide (PubChem CID 65036837) has the molecular formula C11H12Cl2INO2 and a molecular weight of 388.03 g/mol. Its IUPAC name is 3,5-dichloro-N-(3-hydroxy-2-methylpropyl)-2-iodobenzamide.
| Compound Name | 3,5-dichloro-N-(3-hydroxy-2-methylpropyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 65036837 |
| Molecular Formula | C11H12Cl2INO2 |
| Molecular Weight | 388.03 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | 3,5-dichloro-N-(3-hydroxy-2-methylpropyl)-2-iodobenzamide |
| SMILES | CC(CO)CNC(=O)c1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C11H12Cl2INO2/c1-6(5-16)4-15-11(17)8-2-7(12)3-9(13)10(8)14/h2-3,6,16H,4-5H2,1H3,(H,15,17) |
| InChIKey | ZHUWDAWNCPOYPL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.03 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|