C12H14BrCl2NO — CID 114316716
N-(4-bromo-2-methylbutyl)-2,5-dichlorobenzamide (PubChem CID 114316716) has the molecular formula C12H14BrCl2NO and a molecular weight of 339.06 g/mol. Its IUPAC name is N-(4-bromo-2-methylbutyl)-2,5-dichlorobenzamide.
| Compound Name | N-(4-bromo-2-methylbutyl)-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 114316716 |
| Molecular Formula | C12H14BrCl2NO |
| Molecular Weight | 339.06 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | N-(4-bromo-2-methylbutyl)-2,5-dichlorobenzamide |
| SMILES | CC(CCBr)CNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H14BrCl2NO/c1-8(4-5-13)7-16-12(17)10-6-9(14)2-3-11(10)15/h2-3,6,8H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | KITJDGGSGBMBMK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.06 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|