C10H12BrCl2NOS — CID 107966173
N-(4-bromo-2-methylbutyl)-2,5-dichlorothiophene-3-carboxamide (PubChem CID 107966173) has the molecular formula C10H12BrCl2NOS and a molecular weight of 345.09 g/mol. Its IUPAC name is N-(4-bromo-2-methylbutyl)-2,5-dichlorothiophene-3-carboxamide.
| Compound Name | N-(4-bromo-2-methylbutyl)-2,5-dichlorothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107966173 |
| Molecular Formula | C10H12BrCl2NOS |
| Molecular Weight | 345.09 g/mol |
| Exact Mass | 342.92 |
| IUPAC Name | N-(4-bromo-2-methylbutyl)-2,5-dichlorothiophene-3-carboxamide |
| SMILES | CC(CCBr)CNC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H12BrCl2NOS/c1-6(2-3-11)5-14-10(15)7-4-8(12)16-9(7)13/h4,6H,2-3,5H2,1H3,(H,14,15) |
| InChIKey | ZAERPDZWFXKCJN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.09 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|