C8H9Cl2NO3S — CID 103825906
2,5-dichloro-N-(2,3-dihydroxypropyl)thiophene-3-carboxamide (PubChem CID 103825906) has the molecular formula C8H9Cl2NO3S and a molecular weight of 270.14 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,3-dihydroxypropyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-(2,3-dihydroxypropyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 103825906 |
| Molecular Formula | C8H9Cl2NO3S |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | 2,5-dichloro-N-(2,3-dihydroxypropyl)thiophene-3-carboxamide |
| SMILES | O=C(NCC(O)CO)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C8H9Cl2NO3S/c9-6-1-5(7(10)15-6)8(14)11-2-4(13)3-12/h1,4,12-13H,2-3H2,(H,11,14) |
| InChIKey | UVJXISXECGWZEU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |