C9H11ClN2O3 — CID 81233183
4-chloro-N-(2,3-dihydroxypropyl)pyridine-3-carboxamide (PubChem CID 81233183) has the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. Its IUPAC name is 4-chloro-N-(2,3-dihydroxypropyl)pyridine-3-carboxamide.
| Compound Name | 4-chloro-N-(2,3-dihydroxypropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81233183 |
| Molecular Formula | C9H11ClN2O3 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 4-chloro-N-(2,3-dihydroxypropyl)pyridine-3-carboxamide |
| SMILES | O=C(NCC(O)CO)c1cnccc1Cl |
| InChI | InChI=1S/C9H11ClN2O3/c10-8-1-2-11-4-7(8)9(15)12-3-6(14)5-13/h1-2,4,6,13-14H,3,5H2,(H,12,15) |
| InChIKey | FJXNXRRZSDUNOG-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |