About 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene
1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene (PubChem CID 122615437) has the molecular formula C16H12Cl3FO
and a molecular weight of 345.63 g/mol. Its IUPAC name is 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene.
Molecular Properties
| Compound Name | 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene |
| PubChem CID | 122615437 |
| Molecular Formula | C16H12Cl3FO |
| Molecular Weight | 345.63 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene |
| SMILES | COc1ccc([C@H]2[C@H](c3cc(F)cc(Cl)c3)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H12Cl3FO/c1-21-13-4-2-9(3-5-13)14-15(16(14,18)19)10-6-11(17)8-12(20)7-10/h2-8,14-15H,1H3/t14-,15-/m0/s1 |
| InChIKey | UVEOTILLLIFNSY-GJZGRUSLSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene?
The IUPAC name of 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene (CID 122615437) is 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene.
What is the SMILES notation for 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene?
The canonical SMILES for 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene is COc1ccc([C@H]2[C@H](c3cc(F)cc(Cl)c3)C2(Cl)Cl)cc1.
What is the InChIKey of 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene?
The InChIKey is UVEOTILLLIFNSY-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H12Cl3FO/c1-21-13-4-2-9(3-5-13)14-15(16(14,18)19)10-6-11(17)8-12(20)7-10/h2-8,14-15H,1H3/t14-,15-/m0/s1.
What are the key properties of 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene?
1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene has a molecular weight of 345.63 g/mol, XLogP of 5.54, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene is sourced from PubChem (CID 122615437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).