C16H12Cl3FO — CID 122615437
1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene (PubChem CID 122615437) has the molecular formula C16H12Cl3FO and a molecular weight of 345.63 g/mol. Its IUPAC name is 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene.
| Compound Name | 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene |
|---|---|
| PubChem CID | 122615437 |
| Molecular Formula | C16H12Cl3FO |
| Molecular Weight | 345.63 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 1-chloro-3-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]-5-fluorobenzene |
| SMILES | COc1ccc([C@H]2[C@H](c3cc(F)cc(Cl)c3)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H12Cl3FO/c1-21-13-4-2-9(3-5-13)14-15(16(14,18)19)10-6-11(17)8-12(20)7-10/h2-8,14-15H,1H3/t14-,15-/m0/s1 |
| InChIKey | UVEOTILLLIFNSY-GJZGRUSLSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|