C16H12Br2Cl2O — CID 122624725
1,3-dibromo-5-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]benzene (PubChem CID 122624725) has the molecular formula C16H12Br2Cl2O and a molecular weight of 450.99 g/mol. Its IUPAC name is 1,3-dibromo-5-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]benzene.
| Compound Name | 1,3-dibromo-5-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]benzene |
|---|---|
| PubChem CID | 122624725 |
| Molecular Formula | C16H12Br2Cl2O |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 447.86 |
| IUPAC Name | 1,3-dibromo-5-[(1R,3R)-2,2-dichloro-3-(4-methoxyphenyl)cyclopropyl]benzene |
| SMILES | COc1ccc([C@H]2[C@H](c3cc(Br)cc(Br)c3)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H12Br2Cl2O/c1-21-13-4-2-9(3-5-13)14-15(16(14,19)20)10-6-11(17)8-12(18)7-10/h2-8,14-15H,1H3/t14-,15-/m0/s1 |
| InChIKey | TWFMAOXNKLAKGH-GJZGRUSLSA-N |
| XLogP | 6.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|