About 1-bromo-4-methoxybenzene;chromium;formaldehyde
1-bromo-4-methoxybenzene;chromium;formaldehyde (PubChem CID 173400891) has the molecular formula C10H13BrCrO4
and a molecular weight of 329.11 g/mol. Its IUPAC name is 1-bromo-4-methoxybenzene;chromium;formaldehyde.
Molecular Properties
| Compound Name | 1-bromo-4-methoxybenzene;chromium;formaldehyde |
| PubChem CID | 173400891 |
| Molecular Formula | C10H13BrCrO4 |
| Molecular Weight | 329.11 g/mol |
| Exact Mass | 327.94 |
| IUPAC Name | 1-bromo-4-methoxybenzene;chromium;formaldehyde |
| SMILES | C=O.C=O.C=O.COc1ccc(Br)cc1.[Cr] |
| InChI | InChI=1S/C7H7BrO.3CH2O.Cr/c1-9-7-4-2-6(8)3-5-7;3*1-2;/h2-5H,1H3;3*1H2; |
| InChIKey | LSESJBGMIYBUJX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.11 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-bromo-4-methoxybenzene;chromium;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methoxybenzene;chromium;formaldehyde?
The IUPAC name of 1-bromo-4-methoxybenzene;chromium;formaldehyde (CID 173400891) is 1-bromo-4-methoxybenzene;chromium;formaldehyde.
What is the SMILES notation for 1-bromo-4-methoxybenzene;chromium;formaldehyde?
The canonical SMILES for 1-bromo-4-methoxybenzene;chromium;formaldehyde is C=O.C=O.C=O.COc1ccc(Br)cc1.[Cr].
What is the InChIKey of 1-bromo-4-methoxybenzene;chromium;formaldehyde?
The InChIKey is LSESJBGMIYBUJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrO.3CH2O.Cr/c1-9-7-4-2-6(8)3-5-7;3*1-2;/h2-5H,1H3;3*1H2;.
What are the key properties of 1-bromo-4-methoxybenzene;chromium;formaldehyde?
1-bromo-4-methoxybenzene;chromium;formaldehyde has a molecular weight of 329.11 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methoxybenzene;chromium;formaldehyde is sourced from PubChem (CID 173400891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).