About lithium;1-bromo-4-methoxybenzene;butane
lithium;1-bromo-4-methoxybenzene;butane (PubChem CID 174553032) has the molecular formula C11H16BrLiO
and a molecular weight of 251.09 g/mol. Its IUPAC name is lithium;1-bromo-4-methoxybenzene;butane.
Molecular Properties
| Compound Name | lithium;1-bromo-4-methoxybenzene;butane |
| PubChem CID | 174553032 |
| Molecular Formula | C11H16BrLiO |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | lithium;1-bromo-4-methoxybenzene;butane |
| SMILES | COc1ccc(Br)cc1.[CH2-]CCC.[Li+] |
| InChI | InChI=1S/C7H7BrO.C4H9.Li/c1-9-7-4-2-6(8)3-5-7;1-3-4-2;/h2-5H,1H3;1,3-4H2,2H3;/q;-1;+1 |
| InChIKey | PVPDZZXECBFCMQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;1-bromo-4-methoxybenzene;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;1-bromo-4-methoxybenzene;butane?
The IUPAC name of lithium;1-bromo-4-methoxybenzene;butane (CID 174553032) is lithium;1-bromo-4-methoxybenzene;butane.
What is the SMILES notation for lithium;1-bromo-4-methoxybenzene;butane?
The canonical SMILES for lithium;1-bromo-4-methoxybenzene;butane is COc1ccc(Br)cc1.[CH2-]CCC.[Li+].
What is the InChIKey of lithium;1-bromo-4-methoxybenzene;butane?
The InChIKey is PVPDZZXECBFCMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrO.C4H9.Li/c1-9-7-4-2-6(8)3-5-7;1-3-4-2;/h2-5H,1H3;1,3-4H2,2H3;/q;-1;+1.
What are the key properties of lithium;1-bromo-4-methoxybenzene;butane?
lithium;1-bromo-4-methoxybenzene;butane has a molecular weight of 251.09 g/mol, XLogP of 1.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;1-bromo-4-methoxybenzene;butane is sourced from PubChem (CID 174553032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).