C14H14O5 — CID 174158364
2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid (PubChem CID 174158364) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid.
| Compound Name | 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174158364 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid |
| SMILES | COc1ccc(C2C3(C(=O)O)CC2(C(=O)O)C3)cc1 |
| InChI | InChI=1S/C14H14O5/c1-19-9-4-2-8(3-5-9)10-13(11(15)16)6-14(10,7-13)12(17)18/h2-5,10H,6-7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | QISCRJGJFVVYRY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |