2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid

C14H14O5 — CID 174158364

IUPAC2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid
SMILESCOc1ccc(C2C3(C(=O)O)CC2(C(=O)O)C3)cc1
InChIInChI=1S/C14H14O5/c1-19-9-4-2-8(3-5-9)10-13(11(15)16)6-14(10,7-13)12(17)18/h2-5,10H,6-7H2,1H3,(H,15,16)(H,17,18)
InChIKeyQISCRJGJFVVYRY-UHFFFAOYSA-N
MW262.26 g/mol
LogP1.73
Rot. Bonds4

About 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid

2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid (PubChem CID 174158364) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid.

Molecular Properties

Compound Name2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid
PubChem CID174158364
Molecular FormulaC14H14O5
Molecular Weight262.26 g/mol
Exact Mass262.08
IUPAC Name2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid
SMILESCOc1ccc(C2C3(C(=O)O)CC2(C(=O)O)C3)cc1
InChIInChI=1S/C14H14O5/c1-19-9-4-2-8(3-5-9)10-13(11(15)16)6-14(10,7-13)12(17)18/h2-5,10H,6-7H2,1H3,(H,15,16)(H,17,18)
InChIKeyQISCRJGJFVVYRY-UHFFFAOYSA-N
XLogP1.73
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.26
LogP ≤ 51.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid?
The IUPAC name of 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid (CID 174158364) is 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid.
What is the SMILES notation for 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid?
The canonical SMILES for 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid is COc1ccc(C2C3(C(=O)O)CC2(C(=O)O)C3)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid?
The InChIKey is QISCRJGJFVVYRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O5/c1-19-9-4-2-8(3-5-9)10-13(11(15)16)6-14(10,7-13)12(17)18/h2-5,10H,6-7H2,1H3,(H,15,16)(H,17,18).
What are the key properties of 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid?
2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid has a molecular weight of 262.26 g/mol, XLogP of 1.73, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylic acid is sourced from PubChem (CID 174158364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).