C16H13ClN2O3 — CID 50906472
4-(4-methoxyphenyl)-2-oxo-3,4-dihydro-1H-quinazoline-6-carbonyl chloride (PubChem CID 50906472) has the molecular formula C16H13ClN2O3 and a molecular weight of 316.74 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-oxo-3,4-dihydro-1H-quinazoline-6-carbonyl chloride.
| Compound Name | 4-(4-methoxyphenyl)-2-oxo-3,4-dihydro-1H-quinazoline-6-carbonyl chloride |
|---|---|
| PubChem CID | 50906472 |
| Molecular Formula | C16H13ClN2O3 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-oxo-3,4-dihydro-1H-quinazoline-6-carbonyl chloride |
| SMILES | COc1ccc(C2NC(=O)Nc3ccc(C(=O)Cl)cc32)cc1 |
| InChI | InChI=1S/C16H13ClN2O3/c1-22-11-5-2-9(3-6-11)14-12-8-10(15(17)20)4-7-13(12)18-16(21)19-14/h2-8,14H,1H3,(H2,18,19,21) |
| InChIKey | IYCXDPZUCVQOIX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|