C17H17NO3 — CID 135000493
cis-(4-methoxyphenyl) (1S,2S)-1-amino-2-phenylcyclopropane-1-carboxylate (PubChem CID 135000493) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is cis-(4-methoxyphenyl) (1S,2S)-1-amino-2-phenylcyclopropane-1-carboxylate.
| Compound Name | cis-(4-methoxyphenyl) (1S,2S)-1-amino-2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 135000493 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | cis-(4-methoxyphenyl) (1S,2S)-1-amino-2-phenylcyclopropane-1-carboxylate |
| SMILES | COc1ccc(OC(=O)[C@]2(N)C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C17H17NO3/c1-20-13-7-9-14(10-8-13)21-16(19)17(18)11-15(17)12-5-3-2-4-6-12/h2-10,15H,11,18H2,1H3/t15-,17-/m0/s1 |
| InChIKey | TVCDPLPKSSNCTK-RDJZCZTQSA-N |
| XLogP | 2.49 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|