C35H34O6 — CID 67965844
dimethyl 4-(4-hydroxyphenyl)-4-(4-methoxyphenyl)-2,6-diphenylcyclohexane-1,1-dicarboxylate (PubChem CID 67965844) has the molecular formula C35H34O6 and a molecular weight of 550.65 g/mol. Its IUPAC name is dimethyl 4-(4-hydroxyphenyl)-4-(4-methoxyphenyl)-2,6-diphenylcyclohexane-1,1-dicarboxylate.
| Compound Name | dimethyl 4-(4-hydroxyphenyl)-4-(4-methoxyphenyl)-2,6-diphenylcyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 67965844 |
| Molecular Formula | C35H34O6 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | dimethyl 4-(4-hydroxyphenyl)-4-(4-methoxyphenyl)-2,6-diphenylcyclohexane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(c2ccccc2)CC(c2ccc(O)cc2)(c2ccc(OC)cc2)CC1c1ccccc1 |
| InChI | InChI=1S/C35H34O6/c1-39-29-20-16-27(17-21-29)34(26-14-18-28(36)19-15-26)22-30(24-10-6-4-7-11-24)35(32(37)40-2,33(38)41-3)31(23-34)25-12-8-5-9-13-25/h4-21,30-31,36H,22-23H2,1-3H3 |
| InChIKey | RTSDLKPJCQKIFN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|