C27H26O7 — CID 139187578
trimethyl (1R,3S)-3-(4-methoxyphenyl)-3,4-dihydro-1H-anthracene-1,2,2-tricarboxylate (PubChem CID 139187578) has the molecular formula C27H26O7 and a molecular weight of 462.50 g/mol. Its IUPAC name is trimethyl (1R,3S)-3-(4-methoxyphenyl)-3,4-dihydro-1H-anthracene-1,2,2-tricarboxylate.
| Compound Name | trimethyl (1R,3S)-3-(4-methoxyphenyl)-3,4-dihydro-1H-anthracene-1,2,2-tricarboxylate |
|---|---|
| PubChem CID | 139187578 |
| Molecular Formula | C27H26O7 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | trimethyl (1R,3S)-3-(4-methoxyphenyl)-3,4-dihydro-1H-anthracene-1,2,2-tricarboxylate |
| SMILES | COC(=O)[C@@H]1c2cc3ccccc3cc2C[C@@H](c2ccc(OC)cc2)C1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C27H26O7/c1-31-20-11-9-16(10-12-20)22-15-19-13-17-7-5-6-8-18(17)14-21(19)23(24(28)32-2)27(22,25(29)33-3)26(30)34-4/h5-14,22-23H,15H2,1-4H3/t22-,23-/m0/s1 |
| InChIKey | UYIRNLYBQDEPRD-GOTSBHOMSA-N |
| XLogP | 3.78 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|