C16H17NO5 — CID 10357603
cis-dimethyl (2S,4S)-2-cyano-4-(4-methoxyphenyl)cyclobutane-1,1-dicarboxylate (PubChem CID 10357603) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is cis-dimethyl (2S,4S)-2-cyano-4-(4-methoxyphenyl)cyclobutane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (2S,4S)-2-cyano-4-(4-methoxyphenyl)cyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10357603 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | cis-dimethyl (2S,4S)-2-cyano-4-(4-methoxyphenyl)cyclobutane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H](C#N)C[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H17NO5/c1-20-12-6-4-10(5-7-12)13-8-11(9-17)16(13,14(18)21-2)15(19)22-3/h4-7,11,13H,8H2,1-3H3/t11-,13+/m1/s1 |
| InChIKey | SXLMOFYBPZUKJR-YPMHNXCESA-N |
| XLogP | 1.65 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|