C16H17F3O4 — CID 102366013
trans-dimethyl (2S,4S)-2-(4-methylphenyl)-4-(trifluoromethyl)cyclobutane-1,1-dicarboxylate (PubChem CID 102366013) has the molecular formula C16H17F3O4 and a molecular weight of 330.30 g/mol. Its IUPAC name is trans-dimethyl (2S,4S)-2-(4-methylphenyl)-4-(trifluoromethyl)cyclobutane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (2S,4S)-2-(4-methylphenyl)-4-(trifluoromethyl)cyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102366013 |
| Molecular Formula | C16H17F3O4 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | trans-dimethyl (2S,4S)-2-(4-methylphenyl)-4-(trifluoromethyl)cyclobutane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H](C(F)(F)F)C[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C16H17F3O4/c1-9-4-6-10(7-5-9)11-8-12(16(17,18)19)15(11,13(20)22-2)14(21)23-3/h4-7,11-12H,8H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | TYTIOKXMHJGQPF-RYUDHWBXSA-N |
| XLogP | 2.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|