C20H22O3 — CID 172843058
methyl 1-(2-methoxy-5-methylphenyl)-2-(4-methylphenyl)cyclopropane-1-carboxylate (PubChem CID 172843058) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl 1-(2-methoxy-5-methylphenyl)-2-(4-methylphenyl)cyclopropane-1-carboxylate.
| Compound Name | methyl 1-(2-methoxy-5-methylphenyl)-2-(4-methylphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 172843058 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | methyl 1-(2-methoxy-5-methylphenyl)-2-(4-methylphenyl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2cc(C)ccc2OC)CC1c1ccc(C)cc1 |
| InChI | InChI=1S/C20H22O3/c1-13-5-8-15(9-6-13)17-12-20(17,19(21)23-4)16-11-14(2)7-10-18(16)22-3/h5-11,17H,12H2,1-4H3 |
| InChIKey | XBCRQQIOBVPIPA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |