C18H18ClNO3 — CID 164571407
trans-methyl (1R,2S)-2-(6-chloro-3-pyridinyl)-1-(2-methoxy-5-methylphenyl)cyclopropane-1-carboxylate (PubChem CID 164571407) has the molecular formula C18H18ClNO3 and a molecular weight of 331.80 g/mol. Its IUPAC name is trans-methyl (1R,2S)-2-(6-chloro-3-pyridinyl)-1-(2-methoxy-5-methylphenyl)cyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1R,2S)-2-(6-chloro-3-pyridinyl)-1-(2-methoxy-5-methylphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 164571407 |
| Molecular Formula | C18H18ClNO3 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | trans-methyl (1R,2S)-2-(6-chloro-3-pyridinyl)-1-(2-methoxy-5-methylphenyl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(c2cc(C)ccc2OC)C[C@H]1c1ccc(Cl)nc1 |
| InChI | InChI=1S/C18H18ClNO3/c1-11-4-6-15(22-2)13(8-11)18(17(21)23-3)9-14(18)12-5-7-16(19)20-10-12/h4-8,10,14H,9H2,1-3H3/t14-,18-/m0/s1 |
| InChIKey | CIFKBVRDPDQCBY-KSSFIOAISA-N |
| XLogP | 3.65 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|