C18H15Cl4NO3 — CID 162419377
trans-2,2,2-trichloroethyl (1S,2R)-2-(6-chloro-3-pyridinyl)-1-(3-methoxyphenyl)cyclopropane-1-carboxylate (PubChem CID 162419377) has the molecular formula C18H15Cl4NO3 and a molecular weight of 435.13 g/mol. Its IUPAC name is trans-2,2,2-trichloroethyl (1S,2R)-2-(6-chloro-3-pyridinyl)-1-(3-methoxyphenyl)cyclopropane-1-carboxylate.
| Compound Name | trans-2,2,2-trichloroethyl (1S,2R)-2-(6-chloro-3-pyridinyl)-1-(3-methoxyphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 162419377 |
| Molecular Formula | C18H15Cl4NO3 |
| Molecular Weight | 435.13 g/mol |
| Exact Mass | 432.98 |
| IUPAC Name | trans-2,2,2-trichloroethyl (1S,2R)-2-(6-chloro-3-pyridinyl)-1-(3-methoxyphenyl)cyclopropane-1-carboxylate |
| SMILES | COc1cccc([C@]2(C(=O)OCC(Cl)(Cl)Cl)C[C@@H]2c2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C18H15Cl4NO3/c1-25-13-4-2-3-12(7-13)17(16(24)26-10-18(20,21)22)8-14(17)11-5-6-15(19)23-9-11/h2-7,9,14H,8,10H2,1H3/t14-,17-/m1/s1 |
| InChIKey | QFVSFAISMIERJK-RHSMWYFYSA-N |
| XLogP | 5.08 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.13 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|