C19H17Cl3O3 — CID 154715636
trans-2,2,2-trichloroethyl (1S,2R)-1-(4-methoxyphenyl)-2-phenylcyclopropane-1-carboxylate (PubChem CID 154715636) has the molecular formula C19H17Cl3O3 and a molecular weight of 399.70 g/mol. Its IUPAC name is trans-2,2,2-trichloroethyl (1S,2R)-1-(4-methoxyphenyl)-2-phenylcyclopropane-1-carboxylate.
| Compound Name | trans-2,2,2-trichloroethyl (1S,2R)-1-(4-methoxyphenyl)-2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 154715636 |
| Molecular Formula | C19H17Cl3O3 |
| Molecular Weight | 399.70 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | trans-2,2,2-trichloroethyl (1S,2R)-1-(4-methoxyphenyl)-2-phenylcyclopropane-1-carboxylate |
| SMILES | COc1ccc([C@]2(C(=O)OCC(Cl)(Cl)Cl)C[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H17Cl3O3/c1-24-15-9-7-14(8-10-15)18(17(23)25-12-19(20,21)22)11-16(18)13-5-3-2-4-6-13/h2-10,16H,11-12H2,1H3/t16-,18-/m1/s1 |
| InChIKey | YMVDVAOBSQGDLS-SJLPKXTDSA-N |
| XLogP | 5.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.70 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|