C18H14Cl3FO2 — CID 177394993
trans-2,2,2-trichloroethyl (1R,2S)-1-(4-fluorophenyl)-2-phenylcyclopropane-1-carboxylate (PubChem CID 177394993) has the molecular formula C18H14Cl3FO2 and a molecular weight of 387.67 g/mol. Its IUPAC name is trans-2,2,2-trichloroethyl (1R,2S)-1-(4-fluorophenyl)-2-phenylcyclopropane-1-carboxylate.
| Compound Name | trans-2,2,2-trichloroethyl (1R,2S)-1-(4-fluorophenyl)-2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 177394993 |
| Molecular Formula | C18H14Cl3FO2 |
| Molecular Weight | 387.67 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | trans-2,2,2-trichloroethyl (1R,2S)-1-(4-fluorophenyl)-2-phenylcyclopropane-1-carboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)[C@]1(c2ccc(F)cc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H14Cl3FO2/c19-18(20,21)11-24-16(23)17(13-6-8-14(22)9-7-13)10-15(17)12-4-2-1-3-5-12/h1-9,15H,10-11H2/t15-,17-/m0/s1 |
| InChIKey | BEVUVIHHPNSHAJ-RDJZCZTQSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|