C27H28O3 — CID 134970549
(1,2-diphenylcyclopropanecarbonyl) adamantane-1-carboxylate (PubChem CID 134970549) has the molecular formula C27H28O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is (1,2-diphenylcyclopropanecarbonyl) adamantane-1-carboxylate.
| Compound Name | (1,2-diphenylcyclopropanecarbonyl) adamantane-1-carboxylate |
|---|---|
| PubChem CID | 134970549 |
| Molecular Formula | C27H28O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (1,2-diphenylcyclopropanecarbonyl) adamantane-1-carboxylate |
| SMILES | O=C(OC(=O)C1(c2ccccc2)CC1c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H28O3/c28-24(26-14-18-11-19(15-26)13-20(12-18)16-26)30-25(29)27(22-9-5-2-6-10-22)17-23(27)21-7-3-1-4-8-21/h1-10,18-20,23H,11-17H2 |
| InChIKey | JKFCKBHQKCOBNI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|