C15H12BrCl3N2O2 — CID 162419233
cis-2,2,2-trichloroethyl (1R,2S)-1-(4-bromophenyl)-2-pyrazol-1-ylcyclopropane-1-carboxylate (PubChem CID 162419233) has the molecular formula C15H12BrCl3N2O2 and a molecular weight of 438.54 g/mol. Its IUPAC name is cis-2,2,2-trichloroethyl (1R,2S)-1-(4-bromophenyl)-2-pyrazol-1-ylcyclopropane-1-carboxylate.
| Compound Name | cis-2,2,2-trichloroethyl (1R,2S)-1-(4-bromophenyl)-2-pyrazol-1-ylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 162419233 |
| Molecular Formula | C15H12BrCl3N2O2 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 435.91 |
| IUPAC Name | cis-2,2,2-trichloroethyl (1R,2S)-1-(4-bromophenyl)-2-pyrazol-1-ylcyclopropane-1-carboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)[C@@]1(c2ccc(Br)cc2)C[C@@H]1n1cccn1 |
| InChI | InChI=1S/C15H12BrCl3N2O2/c16-11-4-2-10(3-5-11)14(13(22)23-9-15(17,18)19)8-12(14)21-7-1-6-20-21/h1-7,12H,8-9H2/t12-,14+/m0/s1 |
| InChIKey | UGEPGAVTEHZVJU-GXTWGEPZSA-N |
| XLogP | 4.44 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|