C11H11BrCl3NO2 — CID 11188025
2,2,2-trichloroethyl N-[2-(4-bromophenyl)ethyl]carbamate (PubChem CID 11188025) has the molecular formula C11H11BrCl3NO2 and a molecular weight of 375.48 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[2-(4-bromophenyl)ethyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[2-(4-bromophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 11188025 |
| Molecular Formula | C11H11BrCl3NO2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 372.90 |
| IUPAC Name | 2,2,2-trichloroethyl N-[2-(4-bromophenyl)ethyl]carbamate |
| SMILES | O=C(NCCc1ccc(Br)cc1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H11BrCl3NO2/c12-9-3-1-8(2-4-9)5-6-16-10(17)18-7-11(13,14)15/h1-4H,5-7H2,(H,16,17) |
| InChIKey | UOCSIGPXDKZCHT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|