C25H18BrCl3N2O5 — CID 177380149
2,2,2-trichloroethyl (1S)-1-(4-bromophenyl)-2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]cycloprop-2-ene-1-carboxylate (PubChem CID 177380149) has the molecular formula C25H18BrCl3N2O5 and a molecular weight of 612.69 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (1S)-1-(4-bromophenyl)-2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]cycloprop-2-ene-1-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (1S)-1-(4-bromophenyl)-2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]cycloprop-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 177380149 |
| Molecular Formula | C25H18BrCl3N2O5 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 609.95 |
| IUPAC Name | 2,2,2-trichloroethyl (1S)-1-(4-bromophenyl)-2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]cycloprop-2-ene-1-carboxylate |
| SMILES | O=C1CCC(N2Cc3c(cccc3C3=C[C@]3(C(=O)OCC(Cl)(Cl)Cl)c3ccc(Br)cc3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H18BrCl3N2O5/c26-14-6-4-13(5-7-14)24(23(35)36-12-25(27,28)29)10-18(24)15-2-1-3-16-17(15)11-31(22(16)34)19-8-9-20(32)30-21(19)33/h1-7,10,19H,8-9,11-12H2,(H,30,32,33)/t19?,24-/m0/s1 |
| InChIKey | QJPRNMFEJIIKQS-WIIYFNMSSA-N |
| XLogP | 4.46 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|