C24H33N3O7 — CID 174979530
2-[2-[6-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]hexoxy]ethoxy]ethyl carbamate (PubChem CID 174979530) has the molecular formula C24H33N3O7 and a molecular weight of 475.54 g/mol. Its IUPAC name is 2-[2-[6-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]hexoxy]ethoxy]ethyl carbamate.
| Compound Name | 2-[2-[6-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]hexoxy]ethoxy]ethyl carbamate |
|---|---|
| PubChem CID | 174979530 |
| Molecular Formula | C24H33N3O7 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 2-[2-[6-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]hexoxy]ethoxy]ethyl carbamate |
| SMILES | NC(=O)OCCOCCOCCCCCCc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H33N3O7/c25-24(31)34-15-14-33-13-12-32-11-4-2-1-3-6-17-7-5-8-18-19(17)16-27(23(18)30)20-9-10-21(28)26-22(20)29/h5,7-8,20H,1-4,6,9-16H2,(H2,25,31)(H,26,28,29) |
| InChIKey | KSLOMCIORBYEFT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|