C22H19BrCl6N2O6 — CID 99658290
bis(2,2,2-trichloroethyl) (1S,2R,6R,7S)-4-[(4-bromophenyl)methoxy]-12-oxa-8,9-diazatetracyclo[5.2.2.12,6.02,6]dodec-10-ene-8,9-dicarboxylate (PubChem CID 99658290) has the molecular formula C22H19BrCl6N2O6 and a molecular weight of 700.02 g/mol. Its IUPAC name is bis(2,2,2-trichloroethyl) (1S,2R,6R,7S)-4-[(4-bromophenyl)methoxy]-12-oxa-8,9-diazatetracyclo[5.2.2.12,6.02,6]dodec-10-ene-8,9-dicarboxylate.
| Compound Name | bis(2,2,2-trichloroethyl) (1S,2R,6R,7S)-4-[(4-bromophenyl)methoxy]-12-oxa-8,9-diazatetracyclo[5.2.2.12,6.02,6]dodec-10-ene-8,9-dicarboxylate |
|---|---|
| PubChem CID | 99658290 |
| Molecular Formula | C22H19BrCl6N2O6 |
| Molecular Weight | 700.02 g/mol |
| Exact Mass | 695.86 |
| IUPAC Name | bis(2,2,2-trichloroethyl) (1S,2R,6R,7S)-4-[(4-bromophenyl)methoxy]-12-oxa-8,9-diazatetracyclo[5.2.2.12,6.02,6]dodec-10-ene-8,9-dicarboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)N1[C@H]2C=C[C@H](N1C(=O)OCC(Cl)(Cl)Cl)[C@]13CC(OCc4ccc(Br)cc4)C[C@@]21O3 |
| InChI | InChI=1S/C22H19BrCl6N2O6/c23-13-3-1-12(2-4-13)9-34-14-7-19-15-5-6-16(20(19,8-14)37-19)31(18(33)36-11-22(27,28)29)30(15)17(32)35-10-21(24,25)26/h1-6,14-16H,7-11H2/t15-,16-,19+,20+/m0/s1 |
| InChIKey | FPTYZAKIELUXPH-XAMWDVODSA-N |
| XLogP | 6.49 |
| TPSA | 80.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.02 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|