C17H17ClN2O4S — CID 98771169
cis-(1S,2R)-N-[(6-chloro-3-pyridinyl)methylsulfonyl]-2-(3-methoxyphenyl)cyclopropane-1-carboxamide (PubChem CID 98771169) has the molecular formula C17H17ClN2O4S and a molecular weight of 380.85 g/mol. Its IUPAC name is cis-(1S,2R)-N-[(6-chloro-3-pyridinyl)methylsulfonyl]-2-(3-methoxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[(6-chloro-3-pyridinyl)methylsulfonyl]-2-(3-methoxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 98771169 |
| Molecular Formula | C17H17ClN2O4S |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | cis-(1S,2R)-N-[(6-chloro-3-pyridinyl)methylsulfonyl]-2-(3-methoxyphenyl)cyclopropane-1-carboxamide |
| SMILES | COc1cccc([C@@H]2C[C@@H]2C(=O)NS(=O)(=O)Cc2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C17H17ClN2O4S/c1-24-13-4-2-3-12(7-13)14-8-15(14)17(21)20-25(22,23)10-11-5-6-16(18)19-9-11/h2-7,9,14-15H,8,10H2,1H3,(H,20,21)/t14-,15-/m0/s1 |
| InChIKey | MYRGGNIMGXCPRW-GJZGRUSLSA-N |
| XLogP | 2.49 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|