C17H24O3 — CID 81020565
2-(3-methoxyphenyl)-4-propylcyclohexane-1-carboxylic acid (PubChem CID 81020565) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-4-propylcyclohexane-1-carboxylic acid.
| Compound Name | 2-(3-methoxyphenyl)-4-propylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81020565 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-(3-methoxyphenyl)-4-propylcyclohexane-1-carboxylic acid |
| SMILES | CCCC1CCC(C(=O)O)C(c2cccc(OC)c2)C1 |
| InChI | InChI=1S/C17H24O3/c1-3-5-12-8-9-15(17(18)19)16(10-12)13-6-4-7-14(11-13)20-2/h4,6-7,11-12,15-16H,3,5,8-10H2,1-2H3,(H,18,19) |
| InChIKey | YSEOEFPVMKLWRY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |