3-(3-methoxyphenyl)oxane-4-carboxylic acid

C13H16O4 — CID 84798105

IUPAC3-(3-methoxyphenyl)oxane-4-carboxylic acid
SMILESCOc1cccc(C2COCCC2C(=O)O)c1
InChIInChI=1S/C13H16O4/c1-16-10-4-2-3-9(7-10)12-8-17-6-5-11(12)13(14)15/h2-4,7,11-12H,5-6,8H2,1H3,(H,14,15)
InChIKeyIFMBANICOBZOHR-UHFFFAOYSA-N
MW236.27 g/mol
LogP1.90
Rot. Bonds3

About 3-(3-methoxyphenyl)oxane-4-carboxylic acid

3-(3-methoxyphenyl)oxane-4-carboxylic acid (PubChem CID 84798105) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)oxane-4-carboxylic acid.

Molecular Properties

Compound Name3-(3-methoxyphenyl)oxane-4-carboxylic acid
PubChem CID84798105
Molecular FormulaC13H16O4
Molecular Weight236.27 g/mol
Exact Mass236.10
IUPAC Name3-(3-methoxyphenyl)oxane-4-carboxylic acid
SMILESCOc1cccc(C2COCCC2C(=O)O)c1
InChIInChI=1S/C13H16O4/c1-16-10-4-2-3-9(7-10)12-8-17-6-5-11(12)13(14)15/h2-4,7,11-12H,5-6,8H2,1H3,(H,14,15)
InChIKeyIFMBANICOBZOHR-UHFFFAOYSA-N
XLogP1.90
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.27
LogP ≤ 51.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(3-methoxyphenyl)oxane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-(3-methoxyphenyl)oxane-3-carboxylic acid
CID 84798102
2-(3-methoxyphenyl)-4-propylcyclohexane-1-carboxylic acid
CID 81020565
(3S,4R)-4-(3-methoxyphenyl)pyrrolidine-3-carboxylic acid
CID 2762171
(3R,4S)-4-(3-methoxyphenyl)-1-methylpyrrolidine-3-carboxylic acid
CID 99962565
(3R,4R)-4-(3-methoxyphenyl)-1-methylpyrrolidine-3-carboxylic acid
CID 99962564
1-[(1S,2S)-2-(3-methoxyphenyl)cyclopropyl]ethanone
CID 28912388
3-(4-hydroxyphenyl)oxane-4-carboxylic acid
CID 84788544
(3S,4R)-1-acetyl-4-(3-methoxyphenyl)pyrrolidine-3-carboxylic acid
CID 70714398
(3aS,7aS)-2-[2-(3-methoxyphenyl)cyclopropanecarbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid
CID 120627547
2-(3-methoxyphenyl)azetidine-3-carboxylic acid
CID 105460068
2-(3-methoxyphenyl)-1-methylpyrrolidine-3-carboxylic acid
CID 83841819
(3S,4R)-4-(3-methoxyphenyl)-1-sulfamoylpyrrolidine-3-carboxylic acid
CID 72920244

Frequently Asked Questions

What is the IUPAC name of 3-(3-methoxyphenyl)oxane-4-carboxylic acid?
The IUPAC name of 3-(3-methoxyphenyl)oxane-4-carboxylic acid (CID 84798105) is 3-(3-methoxyphenyl)oxane-4-carboxylic acid.
What is the SMILES notation for 3-(3-methoxyphenyl)oxane-4-carboxylic acid?
The canonical SMILES for 3-(3-methoxyphenyl)oxane-4-carboxylic acid is COc1cccc(C2COCCC2C(=O)O)c1.
What is the InChIKey of 3-(3-methoxyphenyl)oxane-4-carboxylic acid?
The InChIKey is IFMBANICOBZOHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4/c1-16-10-4-2-3-9(7-10)12-8-17-6-5-11(12)13(14)15/h2-4,7,11-12H,5-6,8H2,1H3,(H,14,15).
What are the key properties of 3-(3-methoxyphenyl)oxane-4-carboxylic acid?
3-(3-methoxyphenyl)oxane-4-carboxylic acid has a molecular weight of 236.27 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxyphenyl)oxane-4-carboxylic acid is sourced from PubChem (CID 84798105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).