C12H16N2O5S — CID 72920244
(3S,4R)-4-(3-methoxyphenyl)-1-sulfamoylpyrrolidine-3-carboxylic acid (PubChem CID 72920244) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is (3S,4R)-4-(3-methoxyphenyl)-1-sulfamoylpyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4R)-4-(3-methoxyphenyl)-1-sulfamoylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 72920244 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (3S,4R)-4-(3-methoxyphenyl)-1-sulfamoylpyrrolidine-3-carboxylic acid |
| SMILES | COc1cccc([C@@H]2CN(S(N)(=O)=O)C[C@H]2C(=O)O)c1 |
| InChI | InChI=1S/C12H16N2O5S/c1-19-9-4-2-3-8(5-9)10-6-14(20(13,17)18)7-11(10)12(15)16/h2-5,10-11H,6-7H2,1H3,(H,15,16)(H2,13,17,18)/t10-,11+/m0/s1 |
| InChIKey | HJCRJWYDXMTCCK-WDEREUQCSA-N |
| XLogP | -0.00 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |