C13H21N3O3S — CID 86283654
(3R,4S)-3-(dimethylamino)-4-(3-methoxyphenyl)pyrrolidine-1-sulfonamide (PubChem CID 86283654) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is (3R,4S)-3-(dimethylamino)-4-(3-methoxyphenyl)pyrrolidine-1-sulfonamide.
| Compound Name | (3R,4S)-3-(dimethylamino)-4-(3-methoxyphenyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 86283654 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (3R,4S)-3-(dimethylamino)-4-(3-methoxyphenyl)pyrrolidine-1-sulfonamide |
| SMILES | COc1cccc([C@H]2CN(S(N)(=O)=O)C[C@@H]2N(C)C)c1 |
| InChI | InChI=1S/C13H21N3O3S/c1-15(2)13-9-16(20(14,17)18)8-12(13)10-5-4-6-11(7-10)19-3/h4-7,12-13H,8-9H2,1-3H3,(H2,14,17,18)/t12-,13+/m1/s1 |
| InChIKey | NNBLZPNAEAWWLQ-OLZOCXBDSA-N |
| XLogP | 0.23 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |