C14H20O4 — CID 143857791
ethane;3-hydroxy-3-(3-methoxyphenyl)cyclobutane-1-carboxylic acid (PubChem CID 143857791) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is ethane;3-hydroxy-3-(3-methoxyphenyl)cyclobutane-1-carboxylic acid.
| Compound Name | ethane;3-hydroxy-3-(3-methoxyphenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 143857791 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | ethane;3-hydroxy-3-(3-methoxyphenyl)cyclobutane-1-carboxylic acid |
| SMILES | CC.COc1cccc(C2(O)CC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C12H14O4.C2H6/c1-16-10-4-2-3-9(5-10)12(15)6-8(7-12)11(13)14;1-2/h2-5,8,15H,6-7H2,1H3,(H,13,14);1-2H3 |
| InChIKey | KXJUQEWBNNTYLG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |