C15H20O4S — CID 171958423
3-(3-methoxyphenyl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171958423) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(3-methoxyphenyl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171958423 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3-(3-methoxyphenyl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | COc1cccc(C2(O)CC3CCCC(C2)S3(=O)=O)c1 |
| InChI | InChI=1S/C15H20O4S/c1-19-12-5-2-4-11(8-12)15(16)9-13-6-3-7-14(10-15)20(13,17)18/h2,4-5,8,13-14,16H,3,6-7,9-10H2,1H3 |
| InChIKey | GPEWQGLLSOACBW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |