C14H18O3S — CID 171965040
3-(3-methylphenyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171965040) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is 3-(3-methylphenyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(3-methylphenyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171965040 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 3-(3-methylphenyl)-8,8-dioxo-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | Cc1cccc(C2(O)CC3CCC(C2)S3(=O)=O)c1 |
| InChI | InChI=1S/C14H18O3S/c1-10-3-2-4-11(7-10)14(15)8-12-5-6-13(9-14)18(12,16)17/h2-4,7,12-13,15H,5-6,8-9H2,1H3 |
| InChIKey | PHJNPALRKBSYFZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |