C17H19NO2 — CID 15309063
methyl (1S,3R,4R,5R)-3-(4-methylphenyl)-2-azatricyclo[3.2.2.02,4]non-6-ene-4-carboxylate (PubChem CID 15309063) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is methyl (1S,3R,4R,5R)-3-(4-methylphenyl)-2-azatricyclo[3.2.2.02,4]non-6-ene-4-carboxylate.
| Compound Name | methyl (1S,3R,4R,5R)-3-(4-methylphenyl)-2-azatricyclo[3.2.2.02,4]non-6-ene-4-carboxylate |
|---|---|
| PubChem CID | 15309063 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | methyl (1S,3R,4R,5R)-3-(4-methylphenyl)-2-azatricyclo[3.2.2.02,4]non-6-ene-4-carboxylate |
| SMILES | COC(=O)[C@]12[C@H]3C=C[C@H](CC3)N1[C@@H]2c1ccc(C)cc1 |
| InChI | InChI=1S/C17H19NO2/c1-11-3-5-12(6-4-11)15-17(16(19)20-2)13-7-9-14(10-8-13)18(15)17/h3-7,9,13-15H,8,10H2,1-2H3/t13-,14+,15+,17+,18?/m0/s1 |
| InChIKey | ZCDSBXIMRONXHJ-KSHGBIATSA-N |
| XLogP | 2.61 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|