C13H15NO3 — CID 101262561
methyl (2R)-2-(4-methoxyphenyl)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 101262561) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl (2R)-2-(4-methoxyphenyl)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | methyl (2R)-2-(4-methoxyphenyl)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 101262561 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | methyl (2R)-2-(4-methoxyphenyl)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | COC(=O)N1CC=C[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H15NO3/c1-16-11-7-5-10(6-8-11)12-4-3-9-14(12)13(15)17-2/h3-8,12H,9H2,1-2H3/t12-/m1/s1 |
| InChIKey | BGIAPFOVAIFVGY-GFCCVEGCSA-N |
| XLogP | 2.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|