C15H17NO5 — CID 101231603
dimethyl (2S,5R)-5-(4-methoxyphenyl)-2,5-dihydropyrrole-1,2-dicarboxylate (PubChem CID 101231603) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is dimethyl (2S,5R)-5-(4-methoxyphenyl)-2,5-dihydropyrrole-1,2-dicarboxylate.
| Compound Name | dimethyl (2S,5R)-5-(4-methoxyphenyl)-2,5-dihydropyrrole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101231603 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | dimethyl (2S,5R)-5-(4-methoxyphenyl)-2,5-dihydropyrrole-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C=C[C@H](c2ccc(OC)cc2)N1C(=O)OC |
| InChI | InChI=1S/C15H17NO5/c1-19-11-6-4-10(5-7-11)12-8-9-13(14(17)20-2)16(12)15(18)21-3/h4-9,12-13H,1-3H3/t12-,13+/m1/s1 |
| InChIKey | XQSIGRWKYMVZHW-OLZOCXBDSA-N |
| XLogP | 1.92 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|