C33H41NO4Si — CID 101231596
tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(4-methoxyphenyl)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 101231596) has the molecular formula C33H41NO4Si and a molecular weight of 543.78 g/mol. Its IUPAC name is tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(4-methoxyphenyl)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(4-methoxyphenyl)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 101231596 |
| Molecular Formula | C33H41NO4Si |
| Molecular Weight | 543.78 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(4-methoxyphenyl)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | COc1ccc([C@@H]2C=C[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)N2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C33H41NO4Si/c1-32(2,3)38-31(35)34-26(20-23-30(34)25-18-21-27(36-7)22-19-25)24-37-39(33(4,5)6,28-14-10-8-11-15-28)29-16-12-9-13-17-29/h8-23,26,30H,24H2,1-7H3/t26-,30-/m0/s1 |
| InChIKey | JEPAFFARSYQQCV-YZNIXAGQSA-N |
| XLogP | 6.49 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.78 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|