C21H29NO5 — CID 101231607
ditert-butyl (2S,5S)-5-(4-methoxyphenyl)-2,5-dihydropyrrole-1,2-dicarboxylate (PubChem CID 101231607) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is ditert-butyl (2S,5S)-5-(4-methoxyphenyl)-2,5-dihydropyrrole-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,5S)-5-(4-methoxyphenyl)-2,5-dihydropyrrole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101231607 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | ditert-butyl (2S,5S)-5-(4-methoxyphenyl)-2,5-dihydropyrrole-1,2-dicarboxylate |
| SMILES | COc1ccc([C@@H]2C=C[C@@H](C(=O)OC(C)(C)C)N2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H29NO5/c1-20(2,3)26-18(23)17-13-12-16(14-8-10-15(25-7)11-9-14)22(17)19(24)27-21(4,5)6/h8-13,16-17H,1-7H3/t16-,17-/m0/s1 |
| InChIKey | DUUFAKQHZJNYNA-IRXDYDNUSA-N |
| XLogP | 4.25 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|