C14H15NO3 — CID 102297117
methyl 3-(4-methoxyphenyl)-1-prop-2-ynylaziridine-2-carboxylate (PubChem CID 102297117) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is methyl 3-(4-methoxyphenyl)-1-prop-2-ynylaziridine-2-carboxylate.
| Compound Name | methyl 3-(4-methoxyphenyl)-1-prop-2-ynylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 102297117 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | methyl 3-(4-methoxyphenyl)-1-prop-2-ynylaziridine-2-carboxylate |
| SMILES | C#CCN1C(C(=O)OC)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H15NO3/c1-4-9-15-12(13(15)14(16)18-3)10-5-7-11(17-2)8-6-10/h1,5-8,12-13H,9H2,2-3H3 |
| InChIKey | UZZYMESIEPZTEP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|