C15H19NO2 — CID 3231134
4-(4-methoxyphenyl)-1-prop-2-ynylpiperidin-3-ol (PubChem CID 3231134) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1-prop-2-ynylpiperidin-3-ol.
| Compound Name | 4-(4-methoxyphenyl)-1-prop-2-ynylpiperidin-3-ol |
|---|---|
| PubChem CID | 3231134 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4-(4-methoxyphenyl)-1-prop-2-ynylpiperidin-3-ol |
| SMILES | C#CCN1CCC(c2ccc(OC)cc2)C(O)C1 |
| InChI | InChI=1S/C15H19NO2/c1-3-9-16-10-8-14(15(17)11-16)12-4-6-13(18-2)7-5-12/h1,4-7,14-15,17H,8-11H2,2H3 |
| InChIKey | SGWIOGDVPREPDD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|