C13H20BNO3 — CID 170671016
[4-[(3S,4S)-1-ethyl-3-hydroxypiperidin-4-yl]phenyl]boronic acid (PubChem CID 170671016) has the molecular formula C13H20BNO3 and a molecular weight of 249.12 g/mol. Its IUPAC name is [4-[(3S,4S)-1-ethyl-3-hydroxypiperidin-4-yl]phenyl]boronic acid.
| Compound Name | [4-[(3S,4S)-1-ethyl-3-hydroxypiperidin-4-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 170671016 |
| Molecular Formula | C13H20BNO3 |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | [4-[(3S,4S)-1-ethyl-3-hydroxypiperidin-4-yl]phenyl]boronic acid |
| SMILES | CCN1CC[C@@H](c2ccc(B(O)O)cc2)[C@H](O)C1 |
| InChI | InChI=1S/C13H20BNO3/c1-2-15-8-7-12(13(16)9-15)10-3-5-11(6-4-10)14(17)18/h3-6,12-13,16-18H,2,7-9H2,1H3/t12-,13+/m0/s1 |
| InChIKey | SZHVCYUMYZDGTK-QWHCGFSZSA-N |
| XLogP | -0.46 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|