C7H14FNO — CID 67202820
(3S,4R)-1-ethyl-3-fluoropiperidin-4-ol (PubChem CID 67202820) has the molecular formula C7H14FNO and a molecular weight of 147.19 g/mol. Its IUPAC name is (3S,4R)-1-ethyl-3-fluoropiperidin-4-ol.
| Compound Name | (3S,4R)-1-ethyl-3-fluoropiperidin-4-ol |
|---|---|
| PubChem CID | 67202820 |
| Molecular Formula | C7H14FNO |
| Molecular Weight | 147.19 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | (3S,4R)-1-ethyl-3-fluoropiperidin-4-ol |
| SMILES | CCN1CC[C@@H](O)[C@@H](F)C1 |
| InChI | InChI=1S/C7H14FNO/c1-2-9-4-3-7(10)6(8)5-9/h6-7,10H,2-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | NOFRBECEZMRWOE-NKWVEPMBSA-N |
| XLogP | 0.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |