C10H21FN2 — CID 172535668
(3R,4S)-1-ethyl-3-fluoro-N-propan-2-ylpiperidin-4-amine (PubChem CID 172535668) has the molecular formula C10H21FN2 and a molecular weight of 188.29 g/mol. Its IUPAC name is (3R,4S)-1-ethyl-3-fluoro-N-propan-2-ylpiperidin-4-amine.
| Compound Name | (3R,4S)-1-ethyl-3-fluoro-N-propan-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 172535668 |
| Molecular Formula | C10H21FN2 |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.17 |
| IUPAC Name | (3R,4S)-1-ethyl-3-fluoro-N-propan-2-ylpiperidin-4-amine |
| SMILES | CCN1CC[C@H](NC(C)C)[C@H](F)C1 |
| InChI | InChI=1S/C10H21FN2/c1-4-13-6-5-10(9(11)7-13)12-8(2)3/h8-10,12H,4-7H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | FLRLKFJZWXOJSM-ZJUUUORDSA-N |
| XLogP | 1.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |