C10H20FN — CID 126847801
trans-(1R,2R)-N-butan-2-yl-2-fluorocyclohexan-1-amine (PubChem CID 126847801) has the molecular formula C10H20FN and a molecular weight of 173.28 g/mol. Its IUPAC name is trans-(1R,2R)-N-butan-2-yl-2-fluorocyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-N-butan-2-yl-2-fluorocyclohexan-1-amine |
|---|---|
| PubChem CID | 126847801 |
| Molecular Formula | C10H20FN |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.16 |
| IUPAC Name | trans-(1R,2R)-N-butan-2-yl-2-fluorocyclohexan-1-amine |
| SMILES | CCC(C)N[C@@H]1CCCC[C@H]1F |
| InChI | InChI=1S/C10H20FN/c1-3-8(2)12-10-7-5-4-6-9(10)11/h8-10,12H,3-7H2,1-2H3/t8?,9-,10-/m1/s1 |
| InChIKey | MKKZFXXFJWBCBL-VXRWAFEHSA-N |
| XLogP | 2.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |