C9H20N2 — CID 94244956
(3R,4S)-1-ethyl-N,3-dimethylpiperidin-4-amine (PubChem CID 94244956) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is (3R,4S)-1-ethyl-N,3-dimethylpiperidin-4-amine.
| Compound Name | (3R,4S)-1-ethyl-N,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 94244956 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | (3R,4S)-1-ethyl-N,3-dimethylpiperidin-4-amine |
| SMILES | CCN1CC[C@H](NC)[C@H](C)C1 |
| InChI | InChI=1S/C9H20N2/c1-4-11-6-5-9(10-3)8(2)7-11/h8-10H,4-7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | GQWULILKFDIEHL-BDAKNGLRSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |