C8H17NO — CID 143448112
(3S,4R)-1-ethyl-3-methylpiperidin-4-ol (PubChem CID 143448112) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is (3S,4R)-1-ethyl-3-methylpiperidin-4-ol.
| Compound Name | (3S,4R)-1-ethyl-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 143448112 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (3S,4R)-1-ethyl-3-methylpiperidin-4-ol |
| SMILES | CCN1CC[C@@H](O)[C@@H](C)C1 |
| InChI | InChI=1S/C8H17NO/c1-3-9-5-4-8(10)7(2)6-9/h7-8,10H,3-6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | RWSUGYZGBWYYCD-JGVFFNPUSA-N |
| XLogP | 0.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |